Which of the following describes a compound
Study with Quizlet and memorize flashcards containing terms like The bond formed between two nonmetals, which are usually very similar in their tendency to lose or gain electrons, is a(n) _____ bond. This bond involves the _____ of one or more electron pairs between the two atoms., Which of the following statements correctly defines a molecule?, Each …
The compound would conduct electricity if molten. The compound is ionic. The compound is molecular. Which of the following describes the compound KBr? Choose all answers that apply. | The compound would be expected to have a relatively low melting point. If the compound dissolved in water it would be a strong electrolyte.
a. 1.5 x 10². When the numbers 4.2 x 10² and 8.4 x 10¹ are multiplied, the exponent of the result, expressed in proper scientific notation is. a. 1. b.2. c. 3. d. 4. d. 4. As the temperature of a gas is increased, the average kinetic energy of its molecules. A) remains the same.7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H3C OH HO 8) Label each asymmetric carbon in the compound below as R or S. OH CH3 9) Label each asymmetric carbon in the compound below as R or S. OH H CH3 OH H CH3 10) Label each assymetric carbon in the compound ...Study with Quizlet and memorize flashcards containing terms like When they can be easily denatured, distorted, and/or degraded by mild changes to the environment, compounds are called:, What term is used to describe proteins losing their 3D structure as a consequence of changes in the environmental conditions such as excessive heat or salt? A. …Study with Quizlet and memorize flashcards containing terms like Most organic compounds contain carbon and _____., The complexity and variety of organic molecules is due to, Compounds composed of only carbon atoms and hydrogen atoms are called _____. and more. ... Which of the following best describes cis-trans isomers? a. They have …Which of the following describes the compound KI? Choose all answers that apply. ) The compound is molecular. | The compound would conduct electricity if molten. | The compound would be expected to have a relatively low melting point. ]If the compound dissolved in water it would be a strong electrolyte. | The compound is ionic.Which of the following describes the compound AgCH3CO0? Choose all answers that apply. The compound is ionic. ) If the compound dissolved in water it would be a non-electrolyte. ) If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. ) The compound would be expected to be a solid at room temperature and ...Inorganic chemical compounds can be broadly classified into two groups: ionic compounds and molecular compounds. The structure of all ionic compounds is an extended three-dimensional array of alternating positive and negative ions. Since ionic compounds do not take the form of individual molecules, they are represented by …Which of the following describes a compound? (2 points) A single type of atom. A particle that is smaller than an atom. Two or more types of atoms chemically bonded together. …
Study with Quizlet and memorize flashcards containing terms like The term _____ is used to describe how well the electron cloud around an atom responds to changes in its electronic environment. A larger atom will hold its valence electrons _____ tightly than a smaller atom and will therefore have a greater response to the presence of a charged or polar particle nearby., Which of the following ...This problem has been solved! You'll get a detailed solution from a subject matter expert that helps you learn core concepts. Question: Which of the following correctly describe the molecular mass of a compound? Click the answer you think is right. The sum of the atomic masses of all the elements of a compound The sum of the atomic numbers of a ... Q. Mixture have two or more substances chemically combined. 1) Some substances are made up of two or more elements combined together chemically. 2) Properties of these substances are different from their constituent elements. 3) These substances cannot be broken down by physical methods.Study with Quizlet and memorize flashcards containing terms like Which of the following statements is TRUE of an atom? You can see the parts of an atom with a typical lab microscope. There is no other particle in matter that is smaller than an atom. All atoms contain the same number of protons, neutrons, and electrons. A grain of salt contains …A compound is a substance formed when two or more different elements bond together chemically. In the options provided, 'a substance made of two oxygen atoms for each carbon atom' describes a compound, specifically carbon dioxide (CO2). Explanation: In chemistry, a compound is a substance formed when two or more …Final answer. Which of the following describes a neutralization reaction? a reaction in which multiple compounds or elements combine to form a single compound a reaction between chemically equivalent amounts of salt and water to form an acid and a base a reaction in which a single compound breaks down into multiple compounds or …SmartBook 1. Which of the following statements correctly describe covalent compounds? Select all that apply. Click the card to flip 👆. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Covalent compounds contain covalent bonds.
Choose all answers that apply. The compound is ionic. The compound would be expected to be a solid at room temperature and pressure. If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. | If the compound dissolved in water it would be a non-electrolyte. Show transcribed image text.When you mix an acid with an alkali, the compounds produce salt and water, as described by HyperPhysics, hosted by Georgia State University. Chemical reactions during which acid and base properties of compounds are neutralized are called ne...Ions are formed when atoms lose or gain electrons. F- is an example of an anion. In the compound MgO, the Mg ion has a charge of _____, while the O ion has a charge of _____. +2; -2. Match each type of bond to the correct description given. covalent bond ----> attraction between two nuclei and a shared pair of electrons.Solution for 6) Which of the following terms best describes the pair of compounds shown: ... CO2H WH2 CH3 7) Which of the following terms best describes the pair of compounds shown: enantiomers, diastereomers, or the same compound? CH3 H C OH 3. HO Expert Solution. Trending now This is a popular solution! Step by step Solved in 2 …
Tym dealers in michigan.
Study with Quizlet and memorize flashcards containing terms like Rank the states of matter based on increasing strength of intermolecular forces, placing the state whose intermolecular forces are weakest at the top., Which of the following properties of liquids are influenced by intermolecular forces? Select all that apply., Which of the following statements correctly describe the surface ...Which of the following statements correctly describe compounds? Select all that apply. Multiple select question. a. The properties of a compound are the same as the properties of its component elements. b. The components of a compound can be separated physically. c. A compound is a pure substance. d. A compound has a fixed mass ratio of its ... Study with Quizlet and memorize flashcards containing terms like How many covalent bonds are formed by a neutral atom for each of the following elements?, Match. Marked bond in the structure shown with the correct description, In what way does the structural formula of a compound differ from its molecular formula? and more.Chapter 3. Which of the following describes a substance in the liquid physical state? A) The substance has a variable shape. B) The substance has a fixed volume. C) The substance does not compress significantly. D) all of the above. E) none of the above. Click the card to flip 👆.26, 26, 32. An isotope with 15 protons and 17 neutrons will have which symbol? 13. P. 15. An imaginary element zXa consists of two isotopes having masses of 100.0 amu and 102.0 amu. A sample of zXa was found to contain 75.0% of the zX100 isotope and 25.0% of the zX102. Calculate the atomic weight of zXa.
Study with Quizlet and memorize flashcards containing terms like Which of the following statements best describes organic chemistry?, Identify the statements that correctly describe the physical properties of organic compounds., Molecules with stronger intermolecular forces have _____ boiling points compared to molecules with weaker …Classify each of the following substances as an element, a compound, a homogeneous mixture, or a heterogeneous mixture. Sucrose, which is commonly-known as "table sugar" (C 12 H 22 O 11) 2.1: Classifications of Matter is shared under a not declared license and was authored, remixed, and/or curated by LibreTexts.Which of the following are pure substances? Explain.(a) Calcium chloride, used to melt ice on roads, consists of twoelements, calcium and chlorine, in a fixed mass ratio.(b) Sulfur consists of sulfur atoms combined into octatomicmolecules.(c) Baking powder, a leavening agent, contains 26% to 30%sodium hydrogen carbonate and 30% to 35% calcium …Which of the following describes the compound AgCH3CO0? Choose all answers that apply. The compound is ionic. ) If the compound dissolved in water it would be a non-electrolyte. ) If the compound dissolved in water it would be a strong electrolyte. The compound is molecular. ) The compound would be expected to be a solid at room temperature and ...O2 is not a compound; it is a molecule because it contains only one element. To be considered a compound, a substance must meet all of the following criteria: contain at least two elements, be a pure substance, have chemically combined elem...These compounds are typically found in living organisms and are essential to the growth and survival of living systems. Examples of organic compounds include carbohydrates, lipids, proteins, and nucleic acids.Organic compounds play a critical role in many biological processes and are the basis of many important industries such as agriculture ...Clear my choice Question 12 Answer saved Marked out of 1.00 Which of the following terms correctly describes a compound featuring more than one ... B. Polyunsaturated Polyunsaturated = this is the term used to correctly describe a compound with MORE THAN ONE double bond. "Poly" = means "many"One example of this is Polyunsaturated …Study with Quizlet and memorize flashcards containing terms like Write the chemical formula of the ionic compound that is composed of Ti^4+ and O^-2 ions., To represent an ion, the charge of the ion is written as a right _______ next to the element symbol. If the charge is a number other than one, the number is usually written ________ the positive or negative sign., Which of the following ... The next statement that best describes a compound or inorganic substance is the option that indicates that it is a compound without molecules containing carbon.. In the attached image some examples of inorganic compounds are named.. Inorganic chemical compound. Inorganic chemical compound is called all those that are formed …Study with Quizlet and memorize flashcards containing terms like An ionic compound will dissolve when the attraction between the _____ molecules and the ions is greater than the attraction between the _____ themselves., An electric current requires the movement of _____ particles, which could be electrons or ions. A solid ionic substance does not conduct an electric current because the ions ...
Which of the following incorrectly describes cis-1.2-dimethylcyclopentane? A) It is a meso compound B) It is achiral. C) It contains two asymmetric carbons D) Its diastcreomer is trans- 1.2-dimethylcyclopentane E) It has an enantiomer. 2. What is the relationship between the pair of compounds shown: CMa A) enantiomers, B) diastereomers C) the same
Expert-verified. Answer) Option d. Explanation: Microscope is an instrument used to see the microscopic organisms. Th …. Which of the following best describes the function of the field diaphragm on a compound microscope: Select one: O a. The field diaphragm permits researchers to use microscopes in the field. O b.A- molecular formula. B- structural formula. C- ball and stick model. D- space filling model. The bond formed between two nonmetals, which are usually very similar in their tendency to lose or gain electrons, is a (n) _____ bond. This bond involves the _____ of one or more electron pairs between the two atoms.Study with Quizlet and memorize flashcards containing terms like Which of the following options describe the correct format used when writing the chemical formula of a substance? Select all that apply., When naming a compound of two nonmetals, the number of ____ of each element is indicated by a Greek numerical prefix. The first element in the name is numbered only when more than ___ atom(s ... See full list on khanacademy.org Study with Quizlet and memorize flashcards containing terms like Atoms bond in order to attain a full _____ level or shell of electrons. Elements in period 2 seek a total of _____ such electrons while period 1 elements such as hydrogen seek a total of _____., True or false: All of the electrons in a many-electron atom can participate in covalent bonding., Which of …Aug 24, 2020 · Which of the following correctly describes a compound? (4 points) The atoms are chemically bonded together, and they retain their individual physical and chemical properties. The atoms are not chemically bonded, and there is no set ratio for how the atoms can combine together. Click here 👆 to get an answer to your question ️ Which of the following describes a compound. avirgilio726 avirgilio726 30.09.2020 Science Secondary School answered Which of the following describes a ... compound is defined as a chemical substance in which two or more different elements combine chemically in a definite ...
Mickey mouse para imprimir.
Exaggerates crossword.
Question: Spermine (structure shown) is a compound isolated from sperm. Which of the following statements correctly describes an aqueous solution of spermine? NH2(CH2)3NH(CH2)4NH(CH2)3NH2 Question 2 options: A) The hydroxide ion concentration in the solution would be greater than that in pure water.Explanation: a material that is made up of a combination of atoms bonded together best describes a compound. A compound is a pure substance that consists of two or more elements bonded together. Advertisement.Study with Quizlet and memorize flashcards containing terms like Which of the following terms for ionic compounds are correct? Select all that apply. Mg2O Ca3N2 AgCl2 CaO, Which of the following options correctly describes each type of chemical compound? Select all that apply. 1) Molecular compounds tend to contain nonmetals only. 2) …Study with Quizlet and memorize flashcards containing terms like Which of the following best describes a compound?, When chemical bonds form, the valence electrons in an atom can undergo all of the following in relation to other atoms EXCEPT _____., The ratio of elements in the molecular compound ethyl alcohol is: carbon, 2; hydrogen, 6; oxygen, 1. Which is the formula for this compound? and more. Jan 22, 2020 · A compound is a substance made up of two or more different types of atoms that are chemically bonded together. So, two or more types of atoms chemically bonded together describe a " compound". Hence, the correct answer would be an option ( C ). Learn more about the compounds here: Study with Quizlet and memorize flashcards containing terms like Which statement best describes why water is an effective solvent? A. Water's relatively small size allows it to fit between individual atoms, driving them apart. B. Water is an ionic compound that attracts other like molecules. C. Water's hydrophobic nature separates polar and non …See full list on khanacademy.org Study with Quizlet and memorize flashcards containing terms like Explain why the symbol for an atom of the element oxygen and the formula for a molecule of oxygen differ., Write the molecular and empirical formulas of the following compounds: (a) Figure A shows a carbon atom that forms two, separate double bonds with two oxygen atoms. (b) Figure B shows a hydrogen atom which forms a single ...Which of the following statements best describes a compound? A) A compound is less common than a pure element B) A compound contains two or more different elements in a definite ratio C) A compound is exemplified by sodium D) A compound is a solution E) A compound is a pure element Compound interest refers to the interest that an account accumulates over more than one compounding period. The interest that gets added to the account after the first compounding period begins to accrue more interest itself, increasing the...Chemistry. Chemistry questions and answers. The compound, CH3NH2, contains a C-N bond. Which of the following best describes the charge on the nitrogen atom in this compound? And why? a) -1 b) +1 c) Slightly Positive d) Slightly Negative e) Uncharged. ….
Study with Quizlet and memorize flashcards containing terms like Which of the following best describes a compound?, When chemical bonds form, the valence electrons in an atom can undergo all of the following in relation to other atoms EXCEPT _____., The ratio of elements in the molecular compound ethyl alcohol is: carbon, 2; hydrogen, 6; oxygen, 1. Which is the formula for this compound? and more.The Gibbs free energy for the following reaction Na 2 SO 4 + 10 H 2 O ---- > Na 2 SO 4 * 10 H 2 O can be described by ΔG = ΔH - TDS = -77.8 kJ/mol - T (-261 J/mol*K) Based on this equation, it can be estimated that the reaction reverses at 298 K or 25 o C (ΔG =0). The drying process itself is slightly exothermic (ΔH for the process is negative) …Compounds can be classified as ionic or covalent. Molecules are the simplest unit of a covalent compound, and molecules can be represented in many different ways. Atoms are the smallest units of matter that still retain the fundamental chemical properties of an element.Which of the following describes the formation of a compound sentence? A. Two independent clauses are joined by a comma and a conjunction. B. Two dependent clauses are joined by a semicolon. C. A dependent clause is connected to an independent clause with a semicolon. D. A dependent clause is connected to an independent clause …See Answer. Question: Which of the following describes the compound Mn (NO3)2? Choose all answers that apply. The compound is ionic. The compound is molecular. If the compound dissolved in water it would be a non-electrolyte. If the compound dissolved in water it would be a strong electrolyte. The compound would be expected to be a solid at ...Study with Quizlet and memorize flashcards containing terms like Write the chemical formula of the ionic compound that is composed of Ti^4+ and O^-2 ions., To represent an ion, the charge of the ion is written as a right _______ next to the element symbol. If the charge is a number other than one, the number is usually written ________ the positive or negative sign., Which of the following ... Which of the following statements correctly describe covalent compounds? Select all that apply. Most of the compounds that we come in contact with are covalent compounds. Covalent compounds are formed by sharing electrons between atoms. Nitrogen, N2, is a covalent compound. The condenser is a critical component of a compound microscope. It is located beneath the stage and its primary function is to gather and focus light from the microscope's light source onto the specimen being observed. Here is a brief description of the functions of the condenser in a compound microscope:Unit 3 Quiz. Which of the following terms describes a compound which increases or intensifies the activity of a receptor but is less effective than other active compounds? This compound can, therefore, decrease the effectiveness of more active compounds when in competition with them for the same receptor sites. a) antagonist. Which of the following describes a compound, [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1], [text-1-1]